* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-[1-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)ETHYL]PIPERAZINE |
| English Synonyms: | 1-[1-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)ETHYL]PIPERAZINE |
| MDL Number.: | MFCD16850925 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCn1cnnc1C(C)N2CCNCC2 |
| InChi: | InChI=1S/C11H21N5/c1-3-6-16-9-13-14-11(16)10(2)15-7-4-12-5-8-15/h9-10,12H,3-8H2,1-2H3 |
| InChiKey: | InChIKey=UWJHTRRGBOXBJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.