* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-FLUORO-5-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)ANILINE |
| English Synonyms: | 2-FLUORO-5-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)ANILINE |
| MDL Number.: | MFCD16850953 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCn1cnnc1c2ccc(c(c2)N)F |
| InChi: | InChI=1S/C11H13FN4/c1-2-5-16-7-14-15-11(16)8-3-4-9(12)10(13)6-8/h3-4,6-7H,2,5,13H2,1H3 |
| InChiKey: | InChIKey=BMCJBJHAXDIRGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.