* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-FLUORO-3-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)ANILINE |
English Synonyms: | 4-FLUORO-3-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)ANILINE |
MDL Number.: | MFCD16850954 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCn1cnnc1c2cc(ccc2F)N |
InChi: | InChI=1S/C11H13FN4/c1-2-5-16-7-14-15-11(16)9-6-8(13)3-4-10(9)12/h3-4,6-7H,2,5,13H2,1H3 |
InChiKey: | InChIKey=VENQXOXVSSJYEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.