* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AMINO-5-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)PHENOL |
English Synonyms: | 2-AMINO-5-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)PHENOL |
MDL Number.: | MFCD16850955 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCn1cnnc1c2ccc(c(c2)O)N |
InChi: | InChI=1S/C11H14N4O/c1-2-5-15-7-13-14-11(15)8-3-4-9(12)10(16)6-8/h3-4,6-7,16H,2,5,12H2,1H3 |
InChiKey: | InChIKey=AWAKQKBLMVGEIL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.