* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)-1H-PYRAZOL-5-AMINE |
| English Synonyms: | 4-(4-PROPYL-4H-1,2,4-TRIAZOL-3-YL)-1H-PYRAZOL-5-AMINE |
| MDL Number.: | MFCD16851008 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCn1cnnc1c2cn[nH]c2N |
| InChi: | InChI=1S/C8H12N6/c1-2-3-14-5-11-13-8(14)6-4-10-12-7(6)9/h4-5H,2-3H2,1H3,(H3,9,10,12) |
| InChiKey: | InChIKey=JPGSPIWNDBUDKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.