* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)ANILINE |
English Synonyms: | 4-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)ANILINE |
MDL Number.: | MFCD16851442 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1c(ncn1)c2ccc(cc2)N |
InChi: | InChI=1S/C10H12N4/c1-2-14-10(12-7-13-14)8-3-5-9(11)6-4-8/h3-7H,2,11H2,1H3 |
InChiKey: | InChIKey=ZEUNRPUGVWJRHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.