* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)-2-METHYLBUTAN-1-AMINE |
English Synonyms: | 1-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)-2-METHYLBUTAN-1-AMINE |
MDL Number.: | MFCD16851451 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(C)C(c1ncnn1CC)N |
InChi: | InChI=1S/C9H18N4/c1-4-7(3)8(10)9-11-6-12-13(9)5-2/h6-8H,4-5,10H2,1-3H3 |
InChiKey: | InChIKey=AYEYXLVBUDIGDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.