* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)-1-PHENYLETHAN-1-AMINE |
English Synonyms: | 2-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)-1-PHENYLETHAN-1-AMINE |
MDL Number.: | MFCD16851454 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1c(ncn1)CC(c2ccccc2)N |
InChi: | InChI=1S/C12H16N4/c1-2-16-12(14-9-15-16)8-11(13)10-6-4-3-5-7-10/h3-7,9,11H,2,8,13H2,1H3 |
InChiKey: | InChIKey=PNTFCIOPUPQGDS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.