* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)METHYL]ANILINE |
English Synonyms: | 4-[(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)METHYL]ANILINE |
MDL Number.: | MFCD16851461 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1c(ncn1)Cc2ccc(cc2)N |
InChi: | InChI=1S/C11H14N4/c1-2-15-11(13-8-14-15)7-9-3-5-10(12)6-4-9/h3-6,8H,2,7,12H2,1H3 |
InChiKey: | InChIKey=YCEFKEFPAUBPRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.