* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)MORPHOLINE |
English Synonyms: | 2-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)MORPHOLINE |
MDL Number.: | MFCD16851488 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1c(ncn1)C2CNCCO2 |
InChi: | InChI=1S/C8H14N4O/c1-2-12-8(10-6-11-12)7-5-9-3-4-13-7/h6-7,9H,2-5H2,1H3 |
InChiKey: | InChIKey=VMYLNKYMWIZFDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.