* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)CYCLOHEX-3-ENE-1-CARBOXYLIC ACID |
| English Synonyms: | 6-(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)CYCLOHEX-3-ENE-1-CARBOXYLIC ACID |
| MDL Number.: | MFCD16851497 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCn1c(ncn1)C2CC=CCC2C(=O)O |
| InChi: | InChI=1S/C11H15N3O2/c1-2-14-10(12-7-13-14)8-5-3-4-6-9(8)11(15)16/h3-4,7-9H,2,5-6H2,1H3,(H,15,16) |
| InChiKey: | InChIKey=PJCLFFQABICKPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.