* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)METHOXY]ACETIC ACID |
English Synonyms: | 2-[(1-ETHYL-1H-1,2,4-TRIAZOL-5-YL)METHOXY]ACETIC ACID |
MDL Number.: | MFCD16851505 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCn1c(ncn1)COCC(=O)O |
InChi: | InChI=1S/C7H11N3O3/c1-2-10-6(8-5-9-10)3-13-4-7(11)12/h5H,2-4H2,1H3,(H,11,12) |
InChiKey: | InChIKey=IPLFTTFTTNTUQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.