* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AMINO-1-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)PROPAN-2-OL |
English Synonyms: | 1-AMINO-1-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)PROPAN-2-OL |
MDL Number.: | MFCD16851572 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1nc(n(n1)C)C(C(C)O)N |
InChi: | InChI=1S/C7H14N4O/c1-4(12)6(8)7-9-5(2)10-11(7)3/h4,6,12H,8H2,1-3H3 |
InChiKey: | InChIKey=DUDNBSWQHASMPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.