* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(4-METHOXYPYRROLIDIN-2-YL)-1,3-DIMETHYL-1H-1,2,4-TRIAZOLE |
| English Synonyms: | 5-(4-METHOXYPYRROLIDIN-2-YL)-1,3-DIMETHYL-1H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD16851602 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1nc(n(n1)C)C2CC(CN2)OC |
| InChi: | InChI=1S/C9H16N4O/c1-6-11-9(13(2)12-6)8-4-7(14-3)5-10-8/h7-8,10H,4-5H2,1-3H3 |
| InChiKey: | InChIKey=PMCROBQONHWERB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.