* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)-2,3-DIHYDRO-1H-INDOLE |
| English Synonyms: | 5-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)-2,3-DIHYDRO-1H-INDOLE |
| MDL Number.: | MFCD16851603 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1nc(n(n1)C)c2ccc3c(c2)CCN3 |
| InChi: | InChI=1S/C12H14N4/c1-8-14-12(16(2)15-8)10-3-4-11-9(7-10)5-6-13-11/h3-4,7,13H,5-6H2,1-2H3 |
| InChiKey: | InChIKey=JWNNZCKBUDKYBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.