* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)PENTANOIC ACID |
| English Synonyms: | 5-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)PENTANOIC ACID |
| MDL Number.: | MFCD16851631 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1nc(n(n1)C)CCCCC(=O)O |
| InChi: | InChI=1S/C9H15N3O2/c1-7-10-8(12(2)11-7)5-3-4-6-9(13)14/h3-6H2,1-2H3,(H,13,14) |
| InChiKey: | InChIKey=PHRUFRDZRKRSHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.