* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)ACETIC ACID |
English Synonyms: | 2-(DIMETHYL-1H-1,2,4-TRIAZOL-5-YL)ACETIC ACID |
MDL Number.: | MFCD16851634 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1nc(n(n1)C)CC(=O)O |
InChi: | InChI=1S/C6H9N3O2/c1-4-7-5(3-6(10)11)9(2)8-4/h3H2,1-2H3,(H,10,11) |
InChiKey: | InChIKey=GPFWPFNZXZMWJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.