* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-METHYL-4-PROPYL-4H-1,2,4-TRIAZOL-3-AMINE |
| English Synonyms: | 5-METHYL-4-PROPYL-4H-1,2,4-TRIAZOL-3-AMINE |
| MDL Number.: | MFCD16851635 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCn1c(nnc1N)C |
| InChi: | InChI=1S/C6H12N4/c1-3-4-10-5(2)8-9-6(10)7/h3-4H2,1-2H3,(H2,7,9) |
| InChiKey: | InChIKey=IPGZVZFXLSASRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.