* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CYCLOPROPYL-5-METHYL-4H-1,2,4-TRIAZOL-3-AMINE |
| English Synonyms: | 4-CYCLOPROPYL-5-METHYL-4H-1,2,4-TRIAZOL-3-AMINE |
| MDL Number.: | MFCD16851637 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1nnc(n1C2CC2)N |
| InChi: | InChI=1S/C6H10N4/c1-4-8-9-6(7)10(4)5-2-3-5/h5H,2-3H2,1H3,(H2,7,9) |
| InChiKey: | InChIKey=YXPHPCFOLPJINB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.