* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-CYCLOHEXYL-5-METHYL-4H-1,2,4-TRIAZOL-3-AMINE |
English Synonyms: | 4-CYCLOHEXYL-5-METHYL-4H-1,2,4-TRIAZOL-3-AMINE |
MDL Number.: | MFCD16851639 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1nnc(n1C2CCCCC2)N |
InChi: | InChI=1S/C9H16N4/c1-7-11-12-9(10)13(7)8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H2,10,12) |
InChiKey: | InChIKey=CVPSFKAXYNTROB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.