* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-PROPYL-4H-1,2,4-TRIAZOL-3-AMINE |
English Synonyms: | 4-PROPYL-4H-1,2,4-TRIAZOL-3-AMINE ; 4-PROPYL-4H-[1,2,4]TRIAZOL-3-YLAMINE |
MDL Number.: | MFCD16851642 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCn1cnnc1N |
InChi: | InChI=1S/C5H10N4/c1-2-3-9-4-7-8-5(9)6/h4H,2-3H2,1H3,(H2,6,8) |
InChiKey: | InChIKey=SFYKXXAKLXIRDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.