* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]-2-METHYLPROPAN-1-AMINE |
English Synonyms: | 1-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]-2-METHYLPROPAN-1-AMINE |
MDL Number.: | MFCD16852262 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)C(c1nncn1CCOC)N |
InChi: | InChI=1S/C9H18N4O/c1-7(2)8(10)9-12-11-6-13(9)4-5-14-3/h6-8H,4-5,10H2,1-3H3 |
InChiKey: | InChIKey=HQPWGODFOUTXJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.