* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(2-METHOXYETHYL)-3-(4-METHOXYPYRROLIDIN-2-YL)-4H-1,2,4-TRIAZOLE |
| English Synonyms: | 4-(2-METHOXYETHYL)-3-(4-METHOXYPYRROLIDIN-2-YL)-4H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD16852276 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COCCn1cnnc1C2CC(CN2)OC |
| InChi: | InChI=1S/C10H18N4O2/c1-15-4-3-14-7-12-13-10(14)9-5-8(16-2)6-11-9/h7-9,11H,3-6H2,1-2H3 |
| InChiKey: | InChIKey=RFLAFDSYEMYGBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.