* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]-1H-PYRAZOL-5-AMINE |
English Synonyms: | 4-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]-1H-PYRAZOL-5-AMINE |
MDL Number.: | MFCD16852279 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COCCn1cnnc1c2cn[nH]c2N |
InChi: | InChI=1S/C8H12N6O/c1-15-3-2-14-5-11-13-8(14)6-4-10-12-7(6)9/h4-5H,2-3H2,1H3,(H3,9,10,12) |
InChiKey: | InChIKey=WZPNZWTYXOGURD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.