* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]THIOPHEN-2-AMINE |
English Synonyms: | 5-[4-(2-METHOXYETHYL)-4H-1,2,4-TRIAZOL-3-YL]THIOPHEN-2-AMINE |
MDL Number.: | MFCD16852281 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COCCn1cnnc1c2ccc(s2)N |
InChi: | InChI=1S/C9H12N4OS/c1-14-5-4-13-6-11-12-9(13)7-2-3-8(10)15-7/h2-3,6H,4-5,10H2,1H3 |
InChiKey: | InChIKey=UJNXYCXAKPSPNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.