* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-AMINE |
English Synonyms: | 4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-AMINE |
MDL Number.: | MFCD16852296 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)Cn1cnnc1N |
InChi: | InChI=1S/C6H12N4/c1-5(2)3-10-4-8-9-6(10)7/h4-5H,3H2,1-2H3,(H2,7,9) |
InChiKey: | InChIKey=VVWGHFARKRPDGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.