* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-[4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-YL]ANILINE |
| English Synonyms: | 3-[4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-YL]ANILINE |
| MDL Number.: | MFCD16852331 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)Cn1cnnc1c2cccc(c2)N |
| InChi: | InChI=1S/C12H16N4/c1-9(2)7-16-8-14-15-12(16)10-4-3-5-11(13)6-10/h3-6,8-9H,7,13H2,1-2H3 |
| InChiKey: | InChIKey=GIFVMHKBMXIQCE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.