* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-YL]-1H-PYRAZOL-5-AMINE |
English Synonyms: | 4-[4-(2-METHYLPROPYL)-4H-1,2,4-TRIAZOL-3-YL]-1H-PYRAZOL-5-AMINE |
MDL Number.: | MFCD16852344 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)Cn1cnnc1c2cn[nH]c2N |
InChi: | InChI=1S/C9H14N6/c1-6(2)4-15-5-12-14-9(15)7-3-11-13-8(7)10/h3,5-6H,4H2,1-2H3,(H3,10,11,13) |
InChiKey: | InChIKey=VJINEYHSGDOGOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.