* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-CHLORO-6-(PROP-2-YN-1-YLOXY)BENZOIC ACID |
English Synonyms: | 2-CHLORO-6-(PROP-2-YN-1-YLOXY)BENZOIC ACID |
MDL Number.: | MFCD16852819 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C#CCOc1cccc(c1C(=O)O)Cl |
InChi: | InChI=1S/C10H7ClO3/c1-2-6-14-8-5-3-4-7(11)9(8)10(12)13/h1,3-5H,6H2,(H,12,13) |
InChiKey: | InChIKey=HJLJCVWXXVUTRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.