* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(BUTAN-2-YLOXY)-3-METHYLBENZOIC ACID |
| English Synonyms: | 4-(BUTAN-2-YLOXY)-3-METHYLBENZOIC ACID |
| MDL Number.: | MFCD16852915 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(C)Oc1ccc(cc1C)C(=O)O |
| InChi: | InChI=1S/C12H16O3/c1-4-9(3)15-11-6-5-10(12(13)14)7-8(11)2/h5-7,9H,4H2,1-3H3,(H,13,14) |
| InChiKey: | InChIKey=VJEOISATVVWJGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.