* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-2-(1H-1,2,4-TRIAZOL-5-YLSULFANYL)BENZOIC ACID |
| English Synonyms: | 4-METHYL-2-(1H-1,2,4-TRIAZOL-5-YLSULFANYL)BENZOIC ACID |
| MDL Number.: | MFCD16852979 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(c1)Sc2[nH]ncn2)C(=O)O |
| InChi: | InChI=1S/C10H9N3O2S/c1-6-2-3-7(9(14)15)8(4-6)16-10-11-5-12-13-10/h2-5H,1H3,(H,14,15)(H,11,12,13) |
| InChiKey: | InChIKey=HNZDLMPTKNGZNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.