* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(PROPAN-2-YL)-2,3,4,5,6,7-HEXAHYDRO-1,3-BENZOTHIAZOL-2-ONE |
| English Synonyms: | 6-(PROPAN-2-YL)-2,3,4,5,6,7-HEXAHYDRO-1,3-BENZOTHIAZOL-2-ONE |
| MDL Number.: | MFCD16853277 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)C1CCc2c(sc(=O)[nH]2)C1 |
| InChi: | InChI=1S/C10H15NOS/c1-6(2)7-3-4-8-9(5-7)13-10(12)11-8/h6-7H,3-5H2,1-2H3,(H,11,12) |
| InChiKey: | InChIKey=HHXQOLPLOGUQPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.