* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[4-(PROPAN-2-YL)CYCLOHEXYL]ETHAN-1-AMINE |
English Synonyms: | 2-[4-(PROPAN-2-YL)CYCLOHEXYL]ETHAN-1-AMINE |
MDL Number.: | MFCD16853401 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)C1CCC(CC1)CCN |
InChi: | InChI=1S/C11H23N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h9-11H,3-8,12H2,1-2H3 |
InChiKey: | InChIKey=NOSUHJXQIKLGEK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.