* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(PROPAN-2-YL)-1,4-DIAZASPIRO[5.5]UNDECAN-5-ONE |
English Synonyms: | 9-(PROPAN-2-YL)-1,4-DIAZASPIRO[5.5]UNDECAN-5-ONE |
MDL Number.: | MFCD16853410 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)C1CCC2(CC1)C(=O)NCCN2 |
InChi: | InChI=1S/C12H22N2O/c1-9(2)10-3-5-12(6-4-10)11(15)13-7-8-14-12/h9-10,14H,3-8H2,1-2H3,(H,13,15) |
InChiKey: | InChIKey=MWIRJZCRRWZDOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.