* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2-METHYL-1H-IMIDAZOL-1-YL)-4-(PROPAN-2-YL)CYCLOHEXAN-1-OL |
English Synonyms: | 2-(2-METHYL-1H-IMIDAZOL-1-YL)-4-(PROPAN-2-YL)CYCLOHEXAN-1-OL |
MDL Number.: | MFCD16853453 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1nccn1C2CC(CCC2O)C(C)C |
InChi: | InChI=1S/C13H22N2O/c1-9(2)11-4-5-13(16)12(8-11)15-7-6-14-10(15)3/h6-7,9,11-13,16H,4-5,8H2,1-3H3 |
InChiKey: | InChIKey=AAFVJKHOKKRWEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.