* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(PROPAN-2-YL)-2-(2,2,2-TRIFLUOROETHOXY)CYCLOHEXAN-1-OL |
English Synonyms: | 4-(PROPAN-2-YL)-2-(2,2,2-TRIFLUOROETHOXY)CYCLOHEXAN-1-OL |
MDL Number.: | MFCD16853458 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)C1CCC(C(C1)OCC(F)(F)F)O |
InChi: | InChI=1S/C11H19F3O2/c1-7(2)8-3-4-9(15)10(5-8)16-6-11(12,13)14/h7-10,15H,3-6H2,1-2H3 |
InChiKey: | InChIKey=IWCSFCIULRFWCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.