* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(PROPAN-2-YL)-2-PROPOXYCYCLOHEXAN-1-OL |
English Synonyms: | 4-(PROPAN-2-YL)-2-PROPOXYCYCLOHEXAN-1-OL |
MDL Number.: | MFCD16853468 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCOC1CC(CCC1O)C(C)C |
InChi: | InChI=1S/C12H24O2/c1-4-7-14-12-8-10(9(2)3)5-6-11(12)13/h9-13H,4-8H2,1-3H3 |
InChiKey: | InChIKey=QXNMZERWTHNORY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.