* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(PENTAN-3-YL)-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
English Synonyms: | 9-(PENTAN-3-YL)-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
MDL Number.: | MFCD16854911 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(CC)N1C2CCCC1CC(=O)C2 |
InChi: | InChI=1S/C13H23NO/c1-3-10(4-2)14-11-6-5-7-12(14)9-13(15)8-11/h10-12H,3-9H2,1-2H3 |
InChiKey: | InChIKey=XFBXQRFQQBNJTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.