* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(2-METHYLCYCLOPROPYL)-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
| English Synonyms: | 9-(2-METHYLCYCLOPROPYL)-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
| MDL Number.: | MFCD16854954 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC1CC1N2C3CCCC2CC(=O)C3 |
| InChi: | InChI=1S/C12H19NO/c1-8-5-12(8)13-9-3-2-4-10(13)7-11(14)6-9/h8-10,12H,2-7H2,1H3 |
| InChiKey: | InChIKey=VIHZLMPENCVFHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.