* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(PROPAN-2-YL)-N-PROPYL-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
English Synonyms: | 9-(PROPAN-2-YL)-N-PROPYL-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
MDL Number.: | MFCD16855026 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC1CC2CCCC(C1)N2C(C)C |
InChi: | InChI=1S/C14H28N2/c1-4-8-15-12-9-13-6-5-7-14(10-12)16(13)11(2)3/h11-15H,4-10H2,1-3H3 |
InChiKey: | InChIKey=IHIFVPJFMQSMRR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.