* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL 2-(3-OXO-8-AZABICYCLO[3.2.1]OCTAN-8-YL)ACETATE |
| English Synonyms: | METHYL 2-(3-OXO-8-AZABICYCLO[3.2.1]OCTAN-8-YL)ACETATE |
| MDL Number.: | MFCD16855117 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COC(=O)CN1C2CCC1CC(=O)C2 |
| InChi: | InChI=1S/C10H15NO3/c1-14-10(13)6-11-7-2-3-8(11)5-9(12)4-7/h7-8H,2-6H2,1H3 |
| InChiKey: | InChIKey=MHTJMSZADXKVBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.