* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(4-METHOXYBUTYL)-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
| English Synonyms: | 8-(4-METHOXYBUTYL)-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
| MDL Number.: | MFCD16855252 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | COCCCCN1C2CCC1CC(=O)C2 |
| InChi: | InChI=1S/C12H21NO2/c1-15-7-3-2-6-13-10-4-5-11(13)9-12(14)8-10/h10-11H,2-9H2,1H3 |
| InChiKey: | InChIKey=XKXAOQSIUJCJFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.