* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-[(4-METHYL-1,3-THIAZOL-2-YL)METHYL]-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
| English Synonyms: | 8-[(4-METHYL-1,3-THIAZOL-2-YL)METHYL]-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
| MDL Number.: | MFCD16855272 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1csc(n1)CN2C3CCC2CC(=O)C3 |
| InChi: | InChI=1S/C12H16N2OS/c1-8-7-16-12(13-8)6-14-9-2-3-10(14)5-11(15)4-9/h7,9-10H,2-6H2,1H3 |
| InChiKey: | InChIKey=OEOUQYSGOMUTGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.