* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(3-METHYLPHENYL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
| English Synonyms: | 8-(3-METHYLPHENYL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
| MDL Number.: | MFCD16855282 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1)N2C3CCC2CC(C3)N |
| InChi: | InChI=1S/C14H20N2/c1-10-3-2-4-12(7-10)16-13-5-6-14(16)9-11(15)8-13/h2-4,7,11,13-14H,5-6,8-9,15H2,1H3 |
| InChiKey: | InChIKey=ZBUOESZHSMJIHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.