* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-[2-(1H-IMIDAZOL-1-YL)ETHYL]-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
English Synonyms: | 8-[2-(1H-IMIDAZOL-1-YL)ETHYL]-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
MDL Number.: | MFCD16855317 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cn(cn1)CCN2C3CCC2CC(=O)C3 |
InChi: | InChI=1S/C12H17N3O/c16-12-7-10-1-2-11(8-12)15(10)6-5-14-4-3-13-9-14/h3-4,9-11H,1-2,5-8H2 |
InChiKey: | InChIKey=NWDROYWIJHUFSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.