* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(3,5-DIMETHYL-1H-PYRAZOL-4-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
English Synonyms: | 8-(3,5-DIMETHYL-1H-PYRAZOL-4-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
MDL Number.: | MFCD16855360 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1c(c(n[nH]1)C)N2C3CCC2CC(C3)N |
InChi: | InChI=1S/C12H20N4/c1-7-12(8(2)15-14-7)16-10-3-4-11(16)6-9(13)5-10/h9-11H,3-6,13H2,1-2H3,(H,14,15) |
InChiKey: | InChIKey=DBKJXTTYRGPGTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.