* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(3-AMINO-8-AZABICYCLO[3.2.1]OCTAN-8-YL)BUTANAMIDE |
| English Synonyms: | 4-(3-AMINO-8-AZABICYCLO[3.2.1]OCTAN-8-YL)BUTANAMIDE |
| MDL Number.: | MFCD16855371 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C1CC2CC(CC1N2CCCC(=O)N)N |
| InChi: | InChI=1S/C11H21N3O/c12-8-6-9-3-4-10(7-8)14(9)5-1-2-11(13)15/h8-10H,1-7,12H2,(H2,13,15) |
| InChiKey: | InChIKey=ASKWTQQOANPOTK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.