* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2-DIMETHYL-3-[4-(PROPAN-2-YL)PHENYL]PROPAN-1-AMINE |
English Synonyms: | 2,2-DIMETHYL-3-[4-(PROPAN-2-YL)PHENYL]PROPAN-1-AMINE |
MDL Number.: | MFCD16855922 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)c1ccc(cc1)CC(C)(C)CN |
InChi: | InChI=1S/C14H23N/c1-11(2)13-7-5-12(6-8-13)9-14(3,4)10-15/h5-8,11H,9-10,15H2,1-4H3 |
InChiKey: | InChIKey=QABFCYVRYGAWQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.