* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(4-TERT-BUTYLCYCLOHEXYL)-4H-1,2,4-TRIAZOLE-3-THIOL |
| English Synonyms: | 5-(4-TERT-BUTYLCYCLOHEXYL)-4H-1,2,4-TRIAZOLE-3-THIOL |
| MDL Number.: | MFCD16857956 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)C1CCC(CC1)c2[nH]c(nn2)S |
| InChi: | InChI=1S/C12H21N3S/c1-12(2,3)9-6-4-8(5-7-9)10-13-11(16)15-14-10/h8-9H,4-7H2,1-3H3,(H2,13,14,15,16) |
| InChiKey: | InChIKey=OWZGQLXPILKDLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.