* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YL)ETHAN-1-ONE |
| English Synonyms: | 1-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YL)ETHAN-1-ONE |
| MDL Number.: | MFCD16857966 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(=O)C1CCCc2c1cccc2 |
| InChi: | InChI=1S/C12H14O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7,11H,4,6,8H2,1H3 |
| InChiKey: | InChIKey=GQABVRJAGAAIPJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.